ChemNet > CAS > 5617-74-3 3-Oxabicyclo[3.1.0]hexane-2,4-dione
5617-74-3 3-Oxabicyclo[3.1.0]hexane-2,4-dione
| produktnavn |
3-Oxabicyclo[3.1.0]hexane-2,4-dione |
| Engelsk navn |
3-Oxabicyclo[3.1.0]hexane-2,4-dione; 1,2-Cyclopropanedicarboxylic anhydride |
| Molekylær Formel |
C5H4O3 |
| Molekylvekt |
112.0835 |
| InChI |
InChI=1/C5H4O3/c6-4-2-1-3(2)5(7)8-4/h2-3H,1H2 |
| CAS-nummer |
5617-74-3 |
| Molecular Structure |
![5617-74-3 3-Oxabicyclo[3.1.0]hexane-2,4-dione](https://images-a.chemnet.com/suppliers/chembase/664/116664_1.gif)
|
| Tetthet |
1.567g/cm3 |
| Smeltepunkt |
59-61℃ |
| Kokepunkt |
280.5°C at 760 mmHg |
| Brytningsindeks |
1.555 |
| Flammepunktet |
143.3°C |
| Damptrykk |
0.00378mmHg at 25°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
